| Identification | |
| Name: | Benzenesulfinic acid,4-chloro- |
| Synonyms: | Benzenesulfinicacid, p-chloro- (6CI,7CI,8CI);4-Chlorobenzenesulfinic acid;p-Chlorobenzenesulfinic acid; |
| CAS: | 100-03-8 |
| EINECS: | 202-812-2 |
| Molecular Formula: | C6H5ClO2S |
| Molecular Weight: | 176.6207 |
| InChI: | InChI=1S/C6H5ClO2S/c7-5-1-3-6(4-2-5)10(8)9/h1-4H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 93 - 95 C |
| Flash Point: | 173.9°C |
| Boiling Point: | 363.9°Cat760mmHg |
| Density: | 1.61g/cm3 |
| Refractive index: | 1.694 |
| Water Solubility: | Stability Toxicology No toxicology data available. Toxicity data (The meaning of any toxicological abbreviations which appear in this section is given |
| Solubility: |
|
| Appearance: | solid |
| Specification: |
The chemical synonyms of 4-Chlorobenzenesulfinic acid (CAS NO.100-03-8) are p-Chlorobenzenesulphinic acid ; 4-Chlorobenzenesulfinicacid ; P-Chloro benzene sulfinic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 173.9°C |
| Safety Data | |
 |
|
