| Identification | |
| Name: | 4'-Methoxyacetophenone |
| Synonyms: | Acetophenone,4'-methoxy- (8CI);Benzophenone, p-methoxy- (3CI);1-(4-Methoxyphenyl)ethanone;1-Acetyl-4-methoxybenzene;4-Acetylanisole;4-Methoxyphenyl methyl ketone;Acetoanisole;Linarodin;Methyl 4-methoxyphenyl ketone;Methyl p-methoxyphenyl ketone;Novatone;Vananote;p-Acetylanisole;p-Anisyl methyl ketone;p-Methoxy(acetyl)benzene;p-Methoxyacetophenone;p-Methoxyphenyl methyl ketone;para-Methoxyacetophenone; |
| CAS: | 100-06-1 |
| EINECS: | 202-815-9 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.035 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to light. |
| Refractive index: | 1.547 (41 C) |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | White crystalline |
| Specification: |
? 4'-Methoxyacetophenone , with CAS number of 100-06-1, can be called p-Methoxyphenyl methyl ketone ; para-Methoxyacetophenone ; 4-Methoxyacetophenone ; p-Methoxy(acetyl)benzene ; Vananote ; Methyl p-methoxyphenyl ketone ; 4'-Methoxyacetophenone ; 4-Methoxyphenyl methyl ketone ; 1-(4-Methoxyphenyl)ethanone .?4'-Methoxyacetophenone (CAS NO.100-06-1) used to make essence such as cosmetics and soap flavor, can also be used in organic synthesis. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29145000 |
| Storage Temperature: | Do not store in direct sunlight. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
