| Identification | |
| Name: | p-Anisoyl chloride |
| Synonyms: | 4-Methoxybenzoyl chloride; p-Anisoyl chloride solution; 4-Anisoyl chloride |
| CAS: | 100-07-2 |
| EINECS: | 202-816-4 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1729 |
| Density: | 1.26 |
| Stability: | Stable, but reacts violently with water. Ensure no moisture enters the container in which this material is stored, to prevent pressure build-up. Incompatible with water, moisture, strong bases, strong oxidizing agents. |
| Refractive index: | 1.58-1.582 |
| Solubility: | Soluble in ether and acetone. Very soluble in benzene. Slightly soluble in carbon tetrachloride. |
| Appearance: | clear to yellpow semi-solid |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Color: | Clear crystals or amber liquid |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
