| Identification | |
| Name: | 4-Dimethylaminobenzaldehyde |
| Synonyms: | Ehrlichs; N,N-dimethyl-4-amino benzaldehyde; 4-(N,N-Dimethyl)aminobenzaldehyde; p-Dimethylaminobenzaldehyde |
| CAS: | 100-10-7 |
| EINECS: | 202-819-0 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c1-10(2)9-5-3-8(7-11)4-6-9/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.072 g/cm3 |
| Stability: | Stable, but light sensitive. Incompatible with bases, strong oxidizing agents. |
| Refractive index: | n20/D 1.417 |
| Solubility: | AUTOIGNITION |
| Appearance: | white crystalline powder |
| Specification: | White to off white crystalline powder usageEng:In the presence of oxygen, some bacteria, like E.coli, are able to split tryptophan into indole and alpha-aminopropionic acid. This reagent is for detecting the indole and identify the indole-positive and indole-negative microorganisms. Safety Statements:7-16-24/25-26-61-45-39-36/37/39-36 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 24/25:Avoid contact with skin and eyes 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 39:Wear eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | I; II; III |
| HS Code: | 29223900 |
| Sensitive: | Air Sensitive |
| Usage: | Production of dyes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
