| Identification | |
| Name: | Benzene,1-ethyl-4-nitro- |
| Synonyms: | 1-Ethyl-4-nitrobenzene;4-Ethyl-1-nitrobenzene;4-Ethylnitrobenzene;4-Nitro-1-ethylbenzene;NSC 858;p-Ethylnitrobenzene;p-Nitroethylbenzene;p-Nitrophenylethane; |
| CAS: | 100-12-9 |
| EINECS: | 202-786-2 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 195.17 |
| InChI: | InChI=1/C8H9NO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 55-59 °C(lit.) |
| Flash Point: | 107.7°C |
| Boiling Point: | 245-246 °C |
| Density: | 1.127g/cm3 |
| Refractive index: | 1.5445-1.5465 |
| Appearance: | clear yellow liquid |
| Specification: | clear yellow liquid Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 107.7°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
Xi: Irritant
|
 |
|
