| Identification | |
| Name: | Benzene,1-ethenyl-4-nitro- |
| Synonyms: | Styrene,p-nitro- (8CI);(4-Nitrophenyl)ethene;1-Ethenyl-4-nitrobenzene;1-Nitro-4-vinylbenzene;p-Nitrostyrene; |
| CAS: | 100-13-0 |
| Molecular Formula: | C8H7NO2 |
| Molecular Weight: | 149.15 |
| InChI: | InChI=1/C8H7NO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 20°C |
| Flash Point: | 85.3°C |
| Boiling Point: | 120°C 10mm |
| Density: | 1.172g/cm3 |
| Refractive index: | 1.603 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 85.3°C |
| Storage Temperature: | Freezer |
| Safety Data | |
 |
|
