| Identification | ||
| Name: | N-Methyl-4-nitroaniline | |
| Synonyms: | N-Methyl-p-nitroaniline; N1-methyl-4-nitroaniline; p-(methylamino)nitrobenzene; 4-nitro-N-methylaniline; N-monomethyl-p-nitroaniline; | |
| CAS: | 100-15-2 | |
| EINECS: | 202-823-2 | |
| Molecular Formula: | C7H8N2O2 | |
| Molecular Weight: | 152.15 | |
| InChI: | InChI=1/C7H8N2O2/c1-8-6-2-4-7(5-3-6)9(10)11/h2-5,8H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Density: | 1.2 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.619 | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Appearance: | Brownish-yellow prisms with violet reflex (from ethanol) or yellow powder | |
| Specification: |
N-Methyl-4-nitroaniline , its CAS NO. is 100-15-2, the synonyms are 4-Nitro-N-methylaniline ; N-Methyl-p-nitroaniline ; N-Monomethyl-p-nitroaniline ; p-(Methylamino)nitrobenzene . | |
| Packinggroup: | III | |
| Storage Temperature: | Keep containers tightly closed. Store in a cool, dry area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
