| Identification | |
| Name: | 4-Nitrophenylhydrazine |
| Synonyms: | Nitrophenylhydrazine |
| CAS: | 100-16-3 |
| EINECS: | 202-824-8 |
| Molecular Formula: | C6H7N3O2 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3376 |
| Flash Point: | 161.8 oC |
| Boiling Point: | 344 oC at 760 mmHg |
| Density: | 1.419 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.691 |
| Water Solubility: | soluble in hot water |
| Solubility: | soluble in hot water |
| Appearance: | Orange solid. |
| Specification: | white to light yellow crystal powde Safety Statements:16-26-36/37/39-37/39-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | I |
| Flash Point: | 161.8 oC |
| Storage Temperature: | Explosives area |
| Usage: | Used as a reagent for ketones, aliphatic aldehydes. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
