| Identification | |
| Name: | 1,4-Diisopropylbenzene |
| Synonyms: | - |
| CAS: | 100-18-5 |
| EINECS: | 202-826-9 |
| Molecular Formula: | C12H18 |
| Molecular Weight: | 162.27 |
| InChI: | InChI=1/C12H18/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 0.857 |
| Refractive index: | 1.489-1.491 |
| Solubility: | INSOL IN WATER Sol in all proportions of alcohol, ether, acetone, benzene. |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | White solid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
