| Identification | |
| Name: | Ethanone,1-(4-nitrophenyl)- |
| Synonyms: | Acetophenone,4'-nitro- (8CI);Acetophenone, p-nitro- (3CI);1-(4-Nitrophenyl)ethan-1-one;1-(4-Nitrophenyl)ethanone;1-Acetyl-4-nitrobenzene;4-Acetylnitrobenzene;4-Nitrophenyl methyl ketone;Methyl 4-nitrophenyl ketone;Methyl p-nitrophenyl ketone;NSC 41590;p-Acetylnitrobenzene;p-Nitroacetophenone;p-Nitrophenyl methyl ketone; |
| CAS: | 100-19-6 |
| EINECS: | 202-827-4 |
| Molecular Formula: | C8H7NO3 |
| Molecular Weight: | 165.14 |
| InChI: | InChI=1/C8H7NO3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.855g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.558 |
| Solubility: | Slightly soluble |
| Appearance: | Yellow prisms or bright yellow powder. |
| Specification: |
p-Nitroacetophenone (CAS NO.100-19-6) is a nitrated ketone which is reactive with many acids and bases liberating heat and flammable gases (e.g., H2). The amount of heat may be sufficient to start a fire in the unreacted portion of the ketone. Ketones also react with reducing agents such as hydrides, alkali metals, and nitrides to produce flammable gas (H2) and heat. They react violently with aldehydes, HNO3, HNO3 + H2O2, and HClO4.Ketones are incompatible with isocyanates, aldehydes, cyanides, peroxides, and anhydrides. |
| HS Code: | 29147090 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
