| Identification | |
| Name: | N,N,N',N'-Tetramethyl-p-phenylenediamine |
| Synonyms: | N,N,N,N-tetramethyl-P-*phenylenediamine free ba; 1,4-Bis(dimethylamino)benzene~Wursters Blue; N,N,N?N?Tetramethyl-p-phenylene- diamine, [1,4-Bis(dimethylamino)benzene; Wurster? Blue] |
| CAS: | 100-22-1 |
| EINECS: | 202-831-6 |
| Molecular Formula: | C10H16N2 |
| Molecular Weight: | 164.25 |
| InChI: | InChI=1/C10H16N2/c1-11(2)9-5-7-10(8-6-9)12(3)4/h5-8H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 0.992 g/cm3 |
| Stability: | Stable, but may be air or light sensitive. Combustible. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| Refractive index: | 1.577 |
| Water Solubility: | slightly in cold, more in hot water |
| Solubility: | slightly in cold, more in hot water |
| Appearance: | purple to brown crystalline powder |
| Specification: | purple to brown crystalline powder Safety Statements:28-28A-36-26-22 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Color: | off-white to gray |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
