| Identification | ||
| Name: | Benzeneethanol,4-nitro- | |
| Synonyms: | 2-(4-Nitrophenyl)-1-ethanol;2-(4-Nitrophenyl)ethanol;2-(4-Nitrophenyl)ethylalcohol;2-(p-Nitrophenyl)ethanol;1-(2-Hydroxyethyl)-4-nitrobenzene;4-Nitrophenethyl alcohol;NSC 55519;p-Nitrophenethyl alcohol;p-Nitrophenylethyl alcohol;Phenethylalcohol, p-nitro- (6CI,7CI,8CI); | |
| CAS: | 100-27-6 | |
| EINECS: | 202-835-8 | |
| Molecular Formula: | C8H9NO3 | |
| Molecular Weight: | 167.16 | |
| InChI: | InChI=1/C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,10H,5-6H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.27g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.581 | |
| Water Solubility: | ||
| Solubility: | <0.01 g/100 mL at 18 oC | |
| Appearance: | yellow to orange crystalline powder | |
| Specification: | yellow to orange crystalline powder Safety Statements:22-24/25-26-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
|
 |
||
