| Identification | |
| Name: | N,N-Diethylethylenediamine |
| Synonyms: | 2-(Diethylamino)ethylamine; 2-aminoethyldiethylamine |
| CAS: | 100-36-7 |
| EINECS: | 202-844-7 |
| Molecular Formula: | C6H16N2 |
| Molecular Weight: | 116.2 |
| InChI: | InChI=1/C6H16N2/c1-3-8(4-2)6-5-7/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2685 |
| Density: | 0.82 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.435-1.437 |
| Water Solubility: | MISCIBLE |
| Solubility: | MISCIBLE |
| Appearance: | colorless liquid |
| Specification: | CLEAR COLORLESS TO LIGHT YELLOW LIQUID Safety Statements:26-36/37/39-45-25-16-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 25:Avoid contact with eyes 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing |
| Packinggroup: | II |
| HS Code: | 29212900 |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
