| Identification | |
| Name: | N,N-Diethylethanolamine |
| Synonyms: | 2-Diethylaminoethanol; 2-Diethylaminoehtanol; DEAE; Diethylethanolamine |
| CAS: | 100-37-8 |
| EINECS: | 202-845-2 |
| Molecular Formula: | C6H15NO |
| Molecular Weight: | 117.19 |
| InChI: | InChI=1/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2686 |
| Density: | 0.884 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, acids. Moisture sensitive. Hygroscopic. |
| Refractive index: | 1.44-1.442 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | clear to pale yellow liquid |
| Specification: | colourless liquid Safety Statements:25-26-36/37/39-45 25:Avoid contact with eyes 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
