| Identification | |
| Name: | 3-Hydroxybenzaldehyde |
| Synonyms: | meta-Hydroxybenzaldehyde;Benzaldehyde, 3-hydroxy-;m-Formylphenol;3-Formylphenol;3-hydroxyBenzaldehyde;m-hydroxyBenzaldehyde;m-hydroxybenzaldehyde;Benzaldehyde, m-hydroxy-; |
| CAS: | 100-83-4 |
| EINECS: | 202-892-9 |
| Molecular Formula: | C7H6O2 |
| Molecular Weight: | 122.12 |
| InChI: | InChI=1/C7H6O2/c8-5-6-2-1-3-7(9)4-6/h1-5,9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 191oC/50mm |
| Density: | 1.226 g/cm 3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.533 |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE in water |
| Appearance: | Slightly brown crystalline powder. |
| Specification: | Off-White Solid Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29124900 |
| Flash Point: | 191oC/50mm |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Color: | faintly yellow to light brown |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
