| Identification | ||
| Name: | 2-Propenoic acid,3-ethoxy-, ethyl ester | |
| Synonyms: | Acrylicacid, 3-ethoxy-, ethyl ester (6CI,7CI,8CI);Ethyl 3-ethoxy-2-propenoate;Ethyl b-ethoxyacrylate;NSC 6828; | |
| CAS: | 1001-26-9 | |
| Molecular Formula: | C7H12O3 | |
| Molecular Weight: | 144.1684 | |
| InChI: | InChI=1S/C7H12O3/c1-3-9-6-5-7(8)10-4-2/h5-6H,3-4H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Flash Point: | 76 ºC | |
| Density: | 0.998 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | n20/D 1.446(lit.) | |
| Water Solubility: | soluble | |
| Solubility: | soluble | |
| Appearance: | clear, colorless | |
| Specification: |
Ethyl 3 ethyoxy-2-propenoate , its cas register number is 1001-26-9. It also can be called 2-Propenoic acid, 3-ethoxy-, ethyl ester ; 3-Ethoxyacrylic acid ethyl ester ; Ethyl 3-ethoxy-2-propenoate ; Ethyl 3-ethoxyprop-2-enoate . It is a clear slightly yellow liquid. | |
| Packinggroup: | I; II; III | |
| Flash Point: | 76 ºC | |
| Storage Temperature: | 2-8°C | |
| Safety Data | ||
| Hazard Symbols |
Xi: Irritant
|
|
 |
||
