| Identification | |
| Name: | Acetonitrile,2-(acetyloxy)- |
| Synonyms: | Acetonitrile,(acetyloxy)- (9CI); Glycolonitrile, acetate (7CI); Glycolonitrile, acetate(ester) (8CI); 2-Acetoxyacetonitrile; Acetoxyacetonitrile; Acetoxymethylcyanide; Cyanomethyl acetate; NSC 71942 |
| CAS: | 1001-55-4 |
| Molecular Formula: | C4H5 N O2 |
| Molecular Weight: | 99.10 |
| InChI: | InChI=1/C4H5NO2/c1-4(6)7-3-2-5/h3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 61.7°C |
| Boiling Point: | 164°C at 760 mmHg |
| Density: | 1.083g/cm3 |
| Refractive index: | 1.402 |
| Specification: |
Cyanomethyl acetate ,its CAS NO. is 1001-55-4,the synonyms is 2-Acetoxyacetonitrile ; 3-03-00-00401 (Beilstein Handbook Reference) ; Acetic acid cyanomethyl ester ; Acetonitrile, (acetyloxy)- ; Acetyloxyacetonitrile ; BRN 1745113 ; Glycolonitrile, acetate ; HSDB 2124 ; Kyanmethylester kyseliny octove ; NSC 71942 . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 61.7°C |
| Safety Data | |
 |
|
