| Identification | |
| Name: | Pyrimidine,5-methyl-2-(methylthio)- |
| Synonyms: | 5-METHYL-2-METHYLSULFANYL-PYRIMIDINE;Pyrimidine, 5-methyl-2-(methylthio)- (6CI,9CI) |
| CAS: | 100114-24-7 |
| Molecular Formula: | C6H8 N2 S |
| Molecular Weight: | 140.20612 |
| InChI: | InChI=1/C6H8N2S/c1-5-3-7-6(9-2)8-4-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.14 |
| Refractive index: | 1.562 |
| Specification: |
The 5-Methyl-2-(methylthio)pyrimidine with the CAS number 100114-24-7 is also called Pyrimidine,5-methyl-2-(methylthio)-. The systematic name is 5-methyl-2-(methylsulfanyl)pyrimidine. Its molecular formula is C6H8N2S. The Product Category is pyrimidine. The properties of the chemical are: (1)ACD/LogP: 1.47; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.47; (4)ACD/LogD (pH 7.4): 1.47; (5)ACD/BCF (pH 5.5): 7.71; (6)ACD/BCF (pH 7.4): 7.71; (7)ACD/KOC (pH 5.5): 150.21; (8)ACD/KOC (pH 7.4): 150.22; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 51.08 Å2; (13)Index of Refraction: 1.562; (14)Molar Refractivity: 39.61 cm3; (15)Molar Volume: 122 cm3; (16)Polarizability: 15.7×10-24cm3; (17)Surface Tension: 50.4 dyne/cm; (18)Enthalpy of Vaporization: 45.49 kJ/mol; (19)Vapour Pressure: 0.0695 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
