| Identification | |
| Name: | Butanoic acid,3-methoxy- |
| Synonyms: | Butyricacid, 3-methoxy- (6CI,8CI); 3-Methoxybutanoic acid; 3-Methoxybutyric acid; NSC2145 |
| CAS: | 10024-70-1 |
| EINECS: | 233-028-9 |
| Molecular Formula: | C5H10 O3 |
| Molecular Weight: | 118.15 |
| InChI: | InChI=1/C5H10O3/c1-4(8-2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 78.6°C |
| Boiling Point: | 193.8°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.42 |
| Specification: |
3-Methoxybutyric acid , its cas register number is 10024-70-1. It also can be called 3-Methoxy butanoic acid ; 3-Methoxybutanoic acid ; Kyselina 3-methoxymaselna ; and Butanoic acid, 3-methoxy- . |
| Flash Point: | 78.6°C |
| Safety Data | |
 |
|
