| Identification | |
| Name: | 1,5-Pentanediol,1,5-dipropanoate |
| Synonyms: | 1,5-Pentanediol,dipropanoate (9CI); 1,5-Pentanediol, dipropionate (8CI); NSC 55131; NSC 67964;Pentamethylene dipropionate |
| CAS: | 10025-09-9 |
| Molecular Formula: | C11H20 O4 |
| Molecular Weight: | 216.31 |
| InChI: | InChI=1/C11H20O4/c1-3-10(12)14-8-6-5-7-9-15-11(13)4-2/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.3°C |
| Boiling Point: | 282.8°C at 760 mmHg |
| Density: | 0.996g/cm3 |
| Refractive index: | 1.434 |
| Specification: |
Pentamethylene dipropionate , its cas register number is 10025-09-9. It also can be called 1,5-Pentanediol, dipropionate ; Pentamethylene glycol dipropionate ; and Propionic acid, pentamethylene ester (2:1) . |
| Flash Point: | 131.3°C |
| Safety Data | |
 |
|
