| Identification | |
| Name: | 1H-Imidazole,2,4,5-tribromo-1-methyl- |
| Synonyms: | Imidazole,2,4,5-tribromo-1-methyl- (7CI,8CI); 1-Methyl-2,4,5-tribromoimidazole;2,4,5-Tribromo-1-methylimidazole |
| CAS: | 1003-91-4 |
| Molecular Formula: | C4H3Br3N2 |
| Molecular Weight: | 318.79 |
| InChI: | InChI=1/C4H3Br3N2/c1-9-3(6)2(5)8-4(9)7/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 84-86°C |
| Flash Point: | 174.5°C |
| Boiling Point: | 364.9°Cat760mmHg |
| Density: | 2.64g/cm3 |
| Refractive index: | 1.726 |
| Specification: |
1H-Imidazole,2,4,5-tribromo-1-methyl- , its cas register number is 1003-91-4. It also can be called 2,4,5-Tribromo-1-methylimidazole ; and 2,4,5-Tribromo-1-methyl-1H-imidazole . |
| Flash Point: | 174.5°C |
| Safety Data | |
 |
|
