| Identification |
| Name: | L(+)-Rhamnose monohydrate |
| Synonyms: | (2R,3R,4S,5S)-2,3,4,5-Tetrahydroxyhexanal hydrate;(2R,3R,4S,5S)-2,3,4,5-Tetrahydroxyhexanalhydrat;6-Deoxy-L-mannose hydrate (1:1);6-Deoxy-L-mannose hydrate; |
| CAS: | 10030-85-0 |
| EINECS: | 222-793-4 |
| Molecular Formula: | C6H14O6 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.556g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.593 |
| Alpha: | 8.2 o (C=4.5,H2O) |
| Solubility: | 300 g/L (20 oC) |
| Appearance: | White crystalline powder. One of the rarer sugars. |
| HS Code: | 29400010 |
| Storage Temperature: | Store in a cool, dry place. |
| Safety Data |
| |
 |
