| Identification |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl- |
| Synonyms: | 1H-Purine-2,6-dione,3,7-dihydro-1-(5-hydroxyhexyl)-3,7-dimethyl-, (R)-; CT 1501R; Lisofylline;Lisophylline; ProTec |
| CAS: | 100324-81-0 |
| Molecular Formula: | C13H20 N4 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3/t9-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 263°C |
| Boiling Point: | 511.2°C at 760 mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.62 |
| Flash Point: | 263°C |
| Usage: | A major metabolite of Pentoxifylline. Methylxanthine that inhibits production of phosphatidic acid during the inflammatory response. Immunomodulator |
| Safety Data |
| |
 |
