| Identification | |
| Name: | 1,4-Dioxane,2,3-bis(2-oxiranylmethoxy)- |
| Synonyms: | 1,4-Dioxane,2,3-bis(oxiranylmethoxy)- (9CI); p-Dioxane, 2,3-bis(2,3-epoxypropoxy)-(7CI,8CI); 2,3-Bis(2,3-epoxypropoxy)-1,4-dioxane |
| CAS: | 10043-09-1 |
| Molecular Formula: | C10H16 O6 |
| Molecular Weight: | 232.26 |
| InChI: | InChI=1/C10H16O6/c1-2-12-10(16-6-8-4-14-8)9(11-1)15-5-7-3-13-7/h7-10H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.3°C |
| Boiling Point: | 387.5°C at 760 mmHg |
| Density: | 1.3g/cm3 |
| Refractive index: | 1.503 |
| Specification: |
The extinguishing agent of 2,3-Bis(2,3-epoxypropoxy)-1,4-dioxane (CAS NO.10043-09-1) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 168.3°C |
| Safety Data | |
 |
|
