| Identification | |
| Name: | Benzoic acid,2-(hydroxyphenylarsino)- |
| Synonyms: | Benzoicacid, o-(hydroxyphenylarsino)- (5CI) |
| CAS: | 100482-34-6 |
| Molecular Formula: | C13H11 As O3 |
| Molecular Weight: | 290.16 |
| InChI: | InChI=1/C13H11AsO3/c15-13(16)11-8-4-5-9-12(11)14(17)10-6-2-1-3-7-10/h1-9,17H,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.4°C |
| Boiling Point: | 458.8°C at 760 mmHg |
| Specification: |
2-Carboxydiphenylarsinous acid , its cas register number is 100482-34-6. It also can be called o-(Phenylhydroxyarsino)benzoic acid ; and Benzoic acid, o-(phenylhydroxyarsino)- . |
| Flash Point: | 245.4°C |
| Safety Data | |
 |
|
