| Identification | |
| Name: | 9-Anthraceneboronic acid |
| Synonyms: | ANTHRACENE-9-BORONIC ACID; 9-Anthracenylboronic acid; 9-Anthrylboronicacid; 9-Boronoanthracene; 9-Anthracenylboronic acid, 9-Anthrylboronic acid |
| CAS: | 100622-34-2 |
| EINECS: | -0 |
| Molecular Formula: | C14H11BO2 |
| Molecular Weight: | 222.05 |
| InChI: | InChI=1/C14H11BO2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,16-17H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 243.8°C |
| Boiling Point: | 479.5°Cat760mmHg |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.709 |
| Appearance: | white powder |
| Specification: |
9-Anthraceneboronic acid (100622-34-2) is boron compounds and electronic Chemicals.And 9-Anthraceneboronic acid (100622-34-2) also can be called for boronic acid, B-9-anthracenyl- and Anthracen-9-ylboronic acid . |
| Flash Point: | 243.8°C |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
