| Identification | |
| Name: | 1H-Pyrazolo[3,4-d]pyrimidin-6-amine,4-chloro- |
| Synonyms: | 4-CHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDIN-6-AMINE |
| CAS: | 100644-65-3 |
| Molecular Formula: | C5H4ClN5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H4ClN5/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H,(H3,7,8,9,10,11) |
| Molecular Structure: | ![(C5H4ClN5) 4-CHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDIN-6-AMINE](https://img1.guidechem.com/chem/e/dict/19/100644-65-3.jpg) |
| Properties | |
| Flash Point: | 259.009°C |
| Boiling Point: | 504.66°C at 760 mmHg |
| Density: | 1.771g/cm3 |
| Refractive index: | 1.827 |
| Specification: |
The 4-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-ylamine with cas registry number of 100644-65-3. Its IUPAC name is 4-chloro-1H-pyrazolo[3,4-d]pyrimidin-6-amine. And it is also named 2-chloro-3,5,7,8-tetrazabicyclo[4.3.0]nona-2,4,8,10-tetraen-4-amine Physical properties about this chemical are: (1)XLogP3-AA: 0.8; (2)H-Bond Donor: 2; (3)H-Bond Acceptor: 4; (4)Rotatable Bond Count: 0; (5)Tautomer Count: 12; (6)Exact Mass: 169.015523; (7)MonoIsotopic Mass: 169.015523; (8)Topological Polar Surface Area: 80.5; (9)Heavy Atom Count: 11; (10)Formal Charge: 0; (11)Complexity: 154; (12)Isotope Atom Count: 0; (13)Defined Atom StereoCenter Count: 0; (14)Undefined Atom StereoCenter Count: 0; (15)Defined Bond StereoCenter Count: 0; (16)Undefined Bond StereoCenter Count: 0; (17)Covalently-Bonded Unit Count: 1. |
| Flash Point: | 259.009°C |
| Safety Data | |
 |
|
