| Identification | |
| Name: | 4-Imidazolidinepropanenitrile,2,5-dioxo- |
| Synonyms: | 4-Imidazolidinepropionitrile,2,5-dioxo- (7CI,8CI); 5-(2-Cyanoethyl)hydantoin; 5-(b-Cyanoethyl)hydantoin |
| CAS: | 1007-06-3 |
| Molecular Formula: | C6H7 N3 O2 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C6H7N3O2/c7-3-1-2-4-5(10)9-6(11)8-4/h4H,1-2H2,(H2,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.263 g/cm3 |
| Refractive index: | 1.483 |
| Specification: |
The 5-(2-Cyanoethyl)hydantoin with the CAS number 1007-06-3 is also called 4-Imidazolidinepropanenitrile,2,5-dioxo-. The systematic name is 3-(2,5-dioxoimidazolidin-4-yl)propanenitrile. Its molecular formula is C6H7N3O2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 5-(2-Cyanoethyl)hydantoin are: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 2.49; (5)ACD/KOC (pH 7.4): 2.44; (6)#H bond acceptors: 5; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 81.99 Å2; (10)Index of Refraction: 1.483; (11)Molar Refractivity: 34.66 cm3; (12)Molar Volume: 121.2 cm3; (13)Polarizability: 13.74×10-24cm3; (14)Surface Tension: 45.4 dyne/cm. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
