| Identification | |
| Name: | 6-Amino-3(2H)-pyridazinone |
| Synonyms: | 3(2H)-pyridazinone, 6-amino-; |
| CAS: | 10071-13-3 |
| Molecular Formula: | C4H5N3O |
| Molecular Weight: | 111.10 |
| InChI: | InChI=1/C4H5N3O/c5-3-1-2-4(8)7-6-3/h1-2H,(H2,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 298-300 deg C |
| Flash Point: | 242.4°C |
| Boiling Point: | 477.2°Cat760mmHg |
| Density: | 1.321g/cm3 |
| Refractive index: | 1.688 |
| Solubility: | Slightly sol in hot alcohol, more sol in hot water SOL IN AQ ALKALI & CERTAIN ORG BASES Sol @ 25 deg C in acetone, 1000 ppm; water, 6000 ppm; dimethylformamide, 20400 ppm; dimethyl sulfoxide, 90000 ppm; xylene In water, 4,507 mg/L at 25 deg C |
| Specification: |
The 6-Amino-3(2H)-pyridazinone with the cas number 10071-13-3 is also called 3(2H)-pyridazinone, 6-amino-. The systematic name is 6-aminopyridazin-3(2H)-one. Its molecular formula is C4H5N3O. The product category of this chemical is Amines. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: -1.28; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.28; (4)ACD/LogD (pH 7.4): -1.28; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 4.77; (8)ACD/KOC (pH 7.4): 4.77; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 35.91 Å2; (13)Index of Refraction: 1.688; (14)Molar Refractivity: 27.3 cm3; (15)Molar Volume: 71.5 cm3; (16)Polarizability: 10.82×10-24cm3; (17)Surface Tension: 69.2 dyne/cm; (18)Enthalpy of Vaporization: 76.68 kJ/mol; (19)Vapour Pressure: 1.19×10-9 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 242.4°C |
| Color: | Crystals from water COLORLESS CRYSTALLINE SOLID |
| Safety Data | |
 |
|
