| Identification |
| Name: | 2-Phenylpyridine |
| Synonyms: | o-Phenylpyridine;1/C11H9N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9;2-Phenyl pyridine;Pyridine, 2-phenyl-; |
| CAS: | 1008-89-5 |
| EINECS: | 213-763-1 |
| Molecular Formula: | C11H9N |
| Molecular Weight: | 155.2 |
| InChI: | InChI=1/C11H9N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.086 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.623 |
| Water Solubility: | Low soluble in water. Fully miscible with ethanol, acetone, toluene, methylene chloride |
| Solubility: | Low soluble in water. Fully miscible with ethanol, acetone, toluene, methylene chloride |
| Appearance: | Light yellow liquid |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
