| Identification | |
| Name: | 1,4-Benzodioxin-2-carbonitrile,2,3-dihydro- |
| Synonyms: | 1,4-Benzodioxan-2-carbonitrile(7CI,8CI);2,3-Dihydro-1,4-benzodioxin-2-carbonitrile;2-Cyano-1,4-benzodioxan; |
| CAS: | 1008-92-0 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.1616 |
| InChI: | InChI=1/C9H7NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.574 |
| Specification: |
The 2,3-Dihydrobenzo[1,4]dioxine-2-carbonitrile with the cas number 1008-92-0 is also called 1,4-Benzodioxin-2-carbonitrile,2,3-dihydro-. The systematic name is 2,3-dihydro-1,4-benzodioxine-2-carbonitrile. Its molecular formula is C9H7NO2. The properties of the chemical are: (1)ACD/LogP: 0.84; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.84; (4)ACD/LogD (pH 7.4): 0.84; (5)ACD/BCF (pH 5.5): 2.58; (6)ACD/BCF (pH 7.4): 2.58; (7)ACD/KOC (pH 5.5): 68.53; (8)ACD/KOC (pH 7.4): 68.53; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 42.25 Å2; (13)Index of Refraction: 1.574; (14)Molar Refractivity: 41.99 cm3; (15)Molar Volume: 127.2 cm3; (16)Polarizability: 16.64×10-24cm3; (17)Surface Tension: 51.3 dyne/cm; (18)Enthalpy of Vaporization: 55.16 kJ/mol; (19)Vapour Pressure: 0.000589 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
