| Identification | |
| Name: | 9,10-Ethanoanthracene-9(10H)-methanamine,N-methyl-, hydrochloride (1:1) |
| Synonyms: | 9,10-Ethanoanthracene-9(10H)-methanamine,N-methyl-, hydrochloride (9CI); 9,10-Ethanoanthracene-9(10H)-methylamine,N-methyl-, hydrochloride (7CI,8CI);9-(Methylaminomethyl)-9,10-dihydro-9,10-ethanoanthracene hydrochloride;Ba-30803; Benzoctamine hydrochloride; Tacitin; Tracitin |
| CAS: | 10085-81-1 |
| EINECS: | 233-216-0 |
| Molecular Formula: | C18H19 N . Cl H |
| Molecular Weight: | 285.84 |
| InChI: | InChI=1/C18H19N.ClH/c1-19-12-18-11-10-13(14-6-2-4-8-16(14)18)15-7-3-5-9-17(15)18;/h2-9,13,19H,10-12H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181.1°C |
| Boiling Point: | 372°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Benzoctamine hydrochloride ,its CAS number is 10085-81-1,it can be called 9,10-Ethanoanthracene-9(10H)-methanamine, N-methyl-, hydrochloride and Methyl(methyl-9,10-ethano-9(10H)-anthryl)ammonium chloride . Benzoctamine hydrochloride (CAS NO. 10085-81-1) is a moderately toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 181.1°C |
| Safety Data | |
 |
|
