| Identification | |
| Name: | 1-Pentanone, 1-phenyl- |
| Synonyms: | Valerophenone(6CI,7CI,8CI);1-Phenyl-1-pentanone;Butyl phenyl ketone;NSC 58959;Pentanophenone;Phenyl butyl ketone;n-Butyl phenyl ketone;n-Valerophenone;1-phenylpentan-1-one; |
| CAS: | 1009-14-9 |
| EINECS: | 213-767-3 |
| Molecular Formula: | C11H14O |
| Molecular Weight: | 162.23 |
| InChI: | InChI=1/C11H14O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.98 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, acids, bases, plastics. |
| Refractive index: | 1.5143-1.5163 |
| Solubility: | Insoluble |
| Appearance: | colourless liquid |
| Specification: |
1-Pentanone, 1-phenyl- (CAS NO.1009-14-9), its Synonyms are 1-Phenyl-1-pentanone ; Valerophenone ; Butyl phenyl ketone . It is colourless liquid. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: |
1-Pentanone, 1-phenyl- (CAS NO.1009-14-9) is used for intermediates of Liquid Crystals . |
| Safety Data | |
 |
|
