| Identification | |
| Name: | Benzene,1-chloro-2-methoxy-4-nitro- |
| Synonyms: | Anisole,2-chloro-5-nitro- (6CI,7CI,8CI);1-Chloro-2-methoxy-4-nitrobenzene;2-Methoxy-4-nitro-1-chlorobenzene;2-Methoxy-4-nitrochlorobenzene;4-Chloro-3-methoxynitrobenzene; |
| CAS: | 1009-36-5 |
| EINECS: | 213-768-9 |
| Molecular Formula: | C7H6ClNO3 |
| Molecular Weight: | 187.58 |
| InChI: | InChI=1/C7H6ClNO3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.5°C |
| Boiling Point: | 287.3°C at760mmHg |
| Density: | 1.366g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
2-Chloro-5-nitroanisole , its cas register number is 1009-36-5. It also can be called Benzene,1-chloro-2-methoxy-4-nitro- ; 2-Methoxy-4-nitrochlorobenzene ; 1-Chloro-2-methoxy-4-nitrobenzene ; and 4-Chloro-3-methoxynitrobenzene . |
| Flash Point: | 127.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
