| Identification | |
| Name: | 2-Butenedioic acid(2Z)-, mono(2-hydroxypropyl) ester (9CI) |
| Synonyms: | 2-Butenedioicacid (Z)-, mono(2-hydroxypropyl) ester; Maleic acid, mono(2-hydroxypropyl)ester (8CI); 2-Hydroxypropyl hydrogen maleate; b-Hydroxypropyl maleate |
| CAS: | 10099-73-7 |
| EINECS: | 233-244-3 |
| Molecular Formula: | C7H10 O5 |
| Molecular Weight: | 174.17 |
| InChI: | InChI=1/C7H10O5/c8-4-1-5-12-7(11)3-2-6(9)10/h2-3,8H,1,4-5H2,(H,9,10)/b3-2- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 163.9°C |
| Boiling Point: | 390.2°C at 760 mmHg |
| Density: | 1.306g/cm3 |
| Refractive index: | 1.503 |
| Report: |
Maleic acid, mono(2-hydroxypropyl) ester (CAS NO.10099-73-7) was reported in AMIHBC AMA Archives of Industrial Hygiene and Occupational Medicine. |
| Flash Point: | 163.9°C |
| Safety Data | |
 |
|
