| Identification | |
| Name: | Benzenamine,3-methoxy-N-phenyl- |
| Synonyms: | m-Anisidine,N-phenyl- (6CI,7CI,8CI);3-Methoxy-N-phenylaniline;N-(3-Methoxyphenyl)-N-phenylamine;N-(m-Methoxyphenyl)aniline;N-Phenyl-m-anisidine;m-Methoxydiphenylamine; |
| CAS: | 101-16-6 |
| EINECS: | 202-921-5 |
| Molecular Formula: | C13H13NO |
| Molecular Weight: | 199.25 |
| InChI: | InChI=1/C13H13NO/c1-15-13-9-5-8-12(10-13)14-11-6-3-2-4-7-11/h2-10,14H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.11 g/cm3 |
| Refractive index: | 1.61 |
| Appearance: | Buff color powder form |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
