| Identification | ||
| Name: | 3-hydroxydiphenylamine | |
| Synonyms: | 3-Anilinophenol; 3-(Phenylamino)-phenol; 3-Hydroxy-N-phenylaniline; 3-Phenylaminophenol | |
| CAS: | 101-18-8 | |
| EINECS: | 202-923-6 | |
| Molecular Formula: | C12H11NO | |
| Molecular Weight: | 185.22 | |
| InChI: | InChI=1/C12H11NO/c14-12-8-4-7-11(9-12)13-10-5-2-1-3-6-10/h1-9,13-14H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Flash Point: | 147.4°C | |
| Density: | 1.216g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.67 | |
| Water Solubility: | SOLVENT | |
| Solubility: | SOLVENT | |
| Appearance: | orange to brown crystals | |
| Specification: | Red brown soli Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection | |
| Packinggroup: | III | |
| Flash Point: | 147.4°C | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
