| Identification | |
| Name: | Carbamic acid,N-(3-chlorophenyl)-, 4-chloro-2-butyn-1-yl ester |
| Synonyms: | Carbamicacid, (3-chlorophenyl)-, 4-chloro-2-butynyl ester (9CI); Carbanilic acid,m-chloro-, 4-chloro-2-butynyl ester (6CI,8CI); 4-Chloro-2-butyn-1-ylN-(3-chlorophenyl)carbamate; 4-Chloro-2-butynyl 3-chlorocarbanilate;4-Chloro-2-butynyl N-(3-chlorophenyl)carbamate; 4-Chloro-2-butynylm-chlorocarbanilate; 4-[N-(3-Chlorophenyl)carbamoyloxy]-1-chloro-2-butyne; A980; A 980 (herbicide); Barban; Barbane; CBN; Carbyne; Carbyne (herbicide); NSC29168; S 847 |
| CAS: | 101-27-9 |
| EINECS: | 202-930-4 |
| Molecular Formula: | C11H9 Cl2 N O2 |
| Molecular Weight: | 258.11 |
| InChI: | InChI=1/C11H9Cl2NO2/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Density: | 1.394 g/cm3 |
| Refractive index: | 1.607 |
| Water Solubility: | Micro dissolve in water, hexane, soluble in benzene |
| Solubility: | Micro dissolve in water, hexane, soluble in benzene |
| Specification: | Safety Statements:24-36/37-60-61 24:Avoid contact with skin 36/37:Wear suitable protective clothing and gloves 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
EPA Genetic Toxicology Program. |
| Storage Temperature: | 0-6°C |
| Color: | Crystalline solid COLORLESS Crystals from n-hexane + benzene |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
