| Identification | |
| Name: | Hexane,1,1,3-triethoxy- |
| Synonyms: | Hexanal,3-ethoxy-, diethyl acetal (6CI,7CI,8CI); 1,1,3-Triethoxyhexane; 3-Ethoxyhexanaldiethyl acetal |
| CAS: | 101-33-7 |
| Molecular Formula: | C12H26 O3 |
| Molecular Weight: | 218.38 |
| InChI: | InChI=1/C12H26O3/c1-5-9-11(13-6-2)10-12(14-7-3)15-8-4/h11-12H,5-10H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -100 |
| Flash Point: | 96.9°C |
| Boiling Point: | 264°Cat760mmHg |
| Density: | 0.885g/cm3 |
| Refractive index: | 1.423 |
| Specification: |
1,1,3-Triethoxyhexane ,its cas register number is 101-33-7. It also can be called Hexanal, 3-ethoxy-, diethyl acetal and Hexane, 1,1,3-triethoxy- . |
| Packinggroup: | Z01 |
| Flash Point: | 96.9°C |
| Safety Data | |
 |
|
