Identification |
Name: | Triallyl cyanurate |
Synonyms: | 2,4,6-Triallyloxy-1,3,5-triazine = Cyanuric Acid Triallyl Ester; 2,4,6-Tris(allyloxy)-1,3,5-triazine; Cyanuric acid triallyl ester~Triallyl cyanurate; 2,4,6-Triallyloxy-1,3,5-triazine, (Triallyl cyanurate) |
CAS: | 101-37-1 |
EINECS: | 202-936-7 |
Molecular Formula: | C12H15N3O3 |
Molecular Weight: | 249.27 |
InChI: | InChI=1/C12H15N3O3/c1-4-7-16-10-13-11(17-8-5-2)15-12(14-10)18-9-6-3/h4-6H,1-3,7-9H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3077 |
Density: | 1.11 |
Stability: | Stable, but moisture-sensitive. Incompatible with acids, peroxides, strong oxidizing agents, copper, iron and its salts. |
Refractive index: | 1.511 |
Water Solubility: | Stability Stable, but moisture-sensitive. Incompatible with acids,peroxides, strong oxidizing agents, copper, iron and its salts. Toxicology Harmful if swallowed. Toxicity data |
Solubility: | |
Appearance: | colourless solid |
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |