| Identification | |
| Name: | 2,6-Dichloroquinone-4-chloroimide |
| Synonyms: | Gibbs; N,2,6-Trichloro-p-benzoquinoneimine; 2,6-dichloro-4-(chloroimino)cyclohexa-2,5-dienone; 3,5-dichloro-p-benzoquinonechlorimine |
| CAS: | 101-38-2 |
| EINECS: | 202-937-2 |
| Molecular Formula: | C6H2Cl3NO |
| Molecular Weight: | 210.44 |
| InChI: | InChI=1/C6H2Cl3NO/c7-4-1-3(10-9)2-5(8)6(4)11/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3224 |
| Flash Point: | 104.3°C |
| Boiling Point: | 262.3°Cat760mmHg |
| Density: | 1.61g/cm3 |
| Stability: | Stable. Keep refrigerated. |
| Refractive index: | 1.612 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | yellow crystals |
| Specification: | yellow crystals Safety Statements:15-26-36/37/39-33-16-36 15:Keep away from heat 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 33:Take precautionary measures against static discharges 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 104.3°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
E:Explosive
Xn:Harmful
|
 |
|
