| Identification | |
| Name: | Methyl phenylacetate |
| Synonyms: | Aceticacid, phenyl-, methyl ester (6CI,8CI);2-Methoxy-1-phenyl-2-oxoethane;Methylbenzeneacetate;Methyl benzeneethanoate;Methylphenylethanoate;Methyl a-phenylacetate;Methyl a-toluate;NSC 401667;NSC 9405;Phenylacetic acid methyl ester;Benzeneaceticacid, methyl ester; |
| CAS: | 101-41-7 |
| EINECS: | 202-940-9 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-11-9(10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Melting Point: | 49 - 50 |
| Density: | 1.04 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.506-1.508 |
| Water Solubility: | Insoluble (Soluble in alcohol, ether) |
| Solubility: | Insoluble (Soluble in alcohol, ether) |
| Appearance: | clear liquid |
| Specification: | colourless liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| HS Code: | 29163500 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Usage: | Used in the flavor industry and in perfumes to impart honey scents. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
