Identification |
Name: | 1,3-Dioxolane,2-(phenylmethyl)- |
Synonyms: | 1,3-Dioxolane,2-benzyl- (6CI,7CI,8CI); 2-(Phenylmethyl)-1,3-dioxolane;2-Benzyl-1,3-dioxolane; 2-Benzyldioxolane; NSC 25480; Phenylacetaldehydeethylene acetal; Phenylacetaldehyde ethylene glycol acetal; Phenylacetaldehydeglycol acetal |
CAS: | 101-49-5 |
EINECS: | 202-946-1 |
Molecular Formula: | C10H12 O2 |
Molecular Weight: | 164.22 |
InChI: | InChI=1/C10H12O2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5,10H,6-8H2 |
Molecular Structure: |
 |
Properties |
Density: | 1.101 g/cm3 |
Refractive index: | n20/D 1.522(lit.) |
Water Solubility: | insoluble in water |
Solubility: | insoluble in water |
Appearance: | Clear colorless to pale yellow liquid |
Specification: |
2-Benzyldioxolan ,its cas register number is 101-49-5. It also can be called Phenylacetaldehyde ethylene acetal ; 1,3-Dioxolane, 2-(phenylmethyl)- ; and 2-Benzyl-1,3-dioxolane .
|
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |