| Identification | |
| Name: | 1,3-Dioxolane,2-(phenylmethyl)- |
| Synonyms: | 1,3-Dioxolane,2-benzyl- (6CI,7CI,8CI); 2-(Phenylmethyl)-1,3-dioxolane;2-Benzyl-1,3-dioxolane; 2-Benzyldioxolane; NSC 25480; Phenylacetaldehydeethylene acetal; Phenylacetaldehyde ethylene glycol acetal; Phenylacetaldehydeglycol acetal |
| CAS: | 101-49-5 |
| EINECS: | 202-946-1 |
| Molecular Formula: | C10H12 O2 |
| Molecular Weight: | 164.22 |
| InChI: | InChI=1/C10H12O2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5,10H,6-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.101 g/cm3 |
| Refractive index: | n20/D 1.522(lit.) |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Clear colorless to pale yellow liquid |
| Specification: |
2-Benzyldioxolan ,its cas register number is 101-49-5. It also can be called Phenylacetaldehyde ethylene acetal ; 1,3-Dioxolane, 2-(phenylmethyl)- ; and 2-Benzyl-1,3-dioxolane . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
