| Identification | |
| Name: | 4-Bromophenyl phenyl ether |
| Synonyms: | 1-bromo-4-phenoxybenzene; 1-BROMO-4-PHENOXY-BENZENE (4-BROMOPHENYL PHENYL ETHER); 4-bromo-1-phenoxy-benzene; 4-Bromodiphenyl ether; p-Bromodiphenyl ether? 4-Bromophenoxybenzene; |
| CAS: | 101-55-3 |
| EINECS: | 202-952-4 |
| Molecular Formula: | C12H9BrO |
| Molecular Weight: | 249.11 |
| InChI: | InChI=1/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 1.423 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.607(lit.) |
| Solubility: | Insoluble |
| Appearance: | colourless liquid |
| Specification: | light yellow liquid Safety Statements:60-61-62-36/37/39-26 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Storage Temperature: | Store at away from heat, flames, or oxidizing materials. Ethers tend to oxidize when exposed to air, forming unstable peroxides that may detonate with extreme violence when concentrated by evaporation or distillation. When combined with other compounds that give a detonable mixture or when disturbed by heat, shock or friction. Appreciable quantities of crystalline solids or a viscous liquid in the bottom of ether-filled containers have been observed as gross evidence of formation of peroxides. |
| Usage: | Research chemical. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
