| Identification | |
| Name: | Benzenamine,4-(4-chlorophenoxy)- |
| Synonyms: | Aniline,p-(p-chlorophenoxy)- (7CI,8CI);4-(4-Chlorophenoxy)aniline;4-(4-Chlorophenoxy)benzenamine;4-Amino-4'-chlorodiphenyl ether;NSC 75571;[4-(4-Chlorophenoxy)phenyl]amine;p-(p-Chlorophenoxy)aniline; |
| CAS: | 101-79-1 |
| EINECS: | 202-976-5 |
| Molecular Formula: | C12H10ClNO |
| Molecular Weight: | 219.67 |
| InChI: | InChI=1/C12H10ClNO/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,14H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.627 |
| Appearance: | Brown Solid |
| Specification: | Dark powder Safety Statements:26-36/37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37:Wear suitable protective clothing and gloves |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
