Identification |
Name: | Benzene,1,1'-methylenebis- |
Synonyms: | Methane,diphenyl- (8CI);1,1'-Methylenebis[benzene];Benzene, (phenylmethyl)-;Benzylbenzene;Ditan;Ditane;NSC 4708; |
CAS: | 101-81-5 |
EINECS: | 202-978-6 |
Molecular Formula: | C13H12 |
Molecular Weight: | 168.24 |
InChI: | InChI=1/C13H12/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-10H,11H2 |
Molecular Structure: |
![(C13H12) Methane,diphenyl- (8CI);1,1'-Methylenebis[benzene];Benzene, (phenylmethyl)-;Benzylbenzene;Ditan;Dita...](https://img.guidechem.com/casimg/101-81-5.gif) |
Properties |
Transport: | OTH |
Density: | 1 |
Refractive index: | 1.576-1.578 |
Water Solubility: | practically insoluble |
Solubility: | practically insoluble |
Appearance: | clear liquid or low melting crystal |
Specification: |
Diphenylmethane (101-81-5) is an organic compound with the formula C13H12. The compound consists of methane wherein two hydrogen atoms are replaced by two phenyl groups.It is prepared by the reaction of benzyl chloride with benzene in the presence of a Lewis acid.and it is mainly used in organic synthesis, but also for determination of mercury reagent and gas chromatography stationary phase.
|
Packinggroup: | III |
Color: | ORTHORHOMBIC NEEDLES Long, colorless needles liquid |
Safety Data |
Hazard Symbols |
|
|
 |