| Identification | |
| Name: | 1-Heptanol,2-(phenylmethylene)- |
| Synonyms: | 1-Heptanol,2-benzylidene- (6CI,8CI); 2-Amyl-3-phenyl-2-propen-1-ol;2-Benzylidene-1-heptanol; 2-Pentyl-3-phenyl-2-propen-1-ol; Buxinol; a-Amylcinnamic alcohol; a-Amylcinnamyl alcohol |
| CAS: | 101-85-9 |
| EINECS: | 202-982-8 |
| Molecular Formula: | C14H20 O |
| Molecular Weight: | 204.34 |
| InChI: | InChI=1/C14H20O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11,15H,2-3,5,10,12H2,1H3/b14-11+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.1°C |
| Boiling Point: | 331.3°Cat760mmHg |
| Density: | 0.971g/cm3 |
| Refractive index: | n20/D 1.519(lit.) |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 134.1°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
