| Identification | |
| Name: | Octanal,2-(phenylmethylene)- |
| Synonyms: | Cinnamaldehyde,a-hexyl- (6CI,8CI);2-(Phenylmethylene)octanal;2-Hexyl-3-phenyl-2-propenal;2-Hexylcinnamaldehyde;Hexyl cinnamic aldehyde;NSC 406799;NSC 46150;a-Hexylcinnamaldehyde;a-Hexylcinnamic aldehyde;a-Hexylcinnamyl aldehyde;a-n-Hexyl-b-phenylacrolein;a-n-Hexylcinnamaldehyde; |
| CAS: | 101-86-0 |
| EINECS: | 202-983-3 |
| Molecular Formula: | C15H20O |
| Molecular Weight: | 216.32 |
| InChI: | InChI=1/C15H20O/c1-2-3-4-6-11-15(13-16)12-14-9-7-5-8-10-14/h5,7-10,12-13H,2-4,6,11H2,1H3/b15-12- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 0.95 |
| Refractive index: | 1.55 |
| Specification: | Safety Statements:26-36/37/39-45-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
