| Identification | ||
| Name: | N,N'-di-sec-butyl-1,4-phenylenediamine | |
| Synonyms: | N,N-Di-sec-butyl-p-phenylenediamine; NN-Bis(1-methylpropyl)-1,4-phenylenediamine; NN-Di-sec-butyl-p-phenylenediamine; Dibutylphenylenediamine; N,N-Disecbutyl-p-Phenylenediamine; Hitec 4720; Topanol M; Antioxidant; N,N'-DIS(1-METHYLPROPYL)-1,4-BENZENEDIAMINE | |
| CAS: | 101-96-2 | |
| EINECS: | 202-992-2 | |
| Molecular Formula: | C14H24N2 | |
| Molecular Weight: | 220.36 | |
| InChI: | InChI=1/C14H24N2/c1-5-11(3)15-13-7-9-14(10-8-13)16-12(4)6-2/h7-12,15-16H,5-6H2,1-4H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2922 | |
| Density: | 0.942 | |
| Stability: | Stable. Combustible. | |
| Refractive index: | 1.539 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 oC | |
| Appearance: | Amber to red or dark reddish black liquid. | |
| Specification: | dark red liquid Safety Statements:26-36/37/39-45-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet | |
| Packinggroup: | III | |
| Storage Temperature: | Keep in a well ventilated area. Keep container tightly closed. | |
| Color: | Amber to red liquid Reddish-brown liquid Pale yellow oil | |
| Usage: | Gasoline gum inhibitor. | |
| Safety Data | ||
| Hazard Symbols |
C:Corrosive
|
|
 |
||
