| Identification | |
| Name: | Ethanol,2-[methyl(phenylmethyl)amino]- |
| Synonyms: | Ethanol,2-(benzylmethylamino)- (6CI,7CI,8CI);2-(Benzylmethylamino)ethanol;2-(N-Methylbenzylamino)ethanol;2-(N-benzyl-N-methylamino)ethanol;2-[Methyl(phenylmethyl)amino]ethanol;Benzyl(2-hydroxyethyl)methylamine;N-Benzyl-N-methyl(2-hydroxyethyl)amine;N-Benzyl-N-methyl-2-aminoethanol;N-Methyl-N-benzylethanolamine;b-(N-Benzyl-N-methylamino)ethanol; |
| CAS: | 101-98-4 |
| EINECS: | 202-994-3 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.23 |
| InChI: | InChI=1/C10H15NO/c1-11(7-8-12)9-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | REM |
| Flash Point: | 110 C |
| Density: | 1.017 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.526-1.532 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | Clear , colourless slightly viscous liquid |
| Specification: | clear yellowish liquid Safety Statements:26-37/39-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes |
| Flash Point: | 110 C |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
